C4HF3N4 — CID 20746472
3-isocyano-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 20746472) has the molecular formula C4HF3N4 and a molecular weight of 162.07 g/mol. Its IUPAC name is 3-isocyano-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-isocyano-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 20746472 |
| Molecular Formula | C4HF3N4 |
| Molecular Weight | 162.07 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 3-isocyano-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | [C-]#[N+]c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C4HF3N4/c1-8-3-9-2(10-11-3)4(5,6)7/h(H,9,10,11) |
| InChIKey | BOZOWFSGXRJNSH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.07 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|