C6H6F3N3 — CID 90807730
3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole;ethene (PubChem CID 90807730) has the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. Its IUPAC name is 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole;ethene.
| Compound Name | 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole;ethene |
|---|---|
| PubChem CID | 90807730 |
| Molecular Formula | C6H6F3N3 |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole;ethene |
| SMILES | C=C.FC(F)=Cc1n[nH]c(F)n1 |
| InChI | InChI=1S/C4H2F3N3.C2H4/c5-2(6)1-3-8-4(7)10-9-3;1-2/h1H,(H,8,9,10);1-2H2 |
| InChIKey | BLGKUECWILIYPM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|