C6H4F3N3O — CID 90768620
3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole;ethenone (PubChem CID 90768620) has the molecular formula C6H4F3N3O and a molecular weight of 191.11 g/mol. Its IUPAC name is 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole;ethenone.
| Compound Name | 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole;ethenone |
|---|---|
| PubChem CID | 90768620 |
| Molecular Formula | C6H4F3N3O |
| Molecular Weight | 191.11 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 3-(2,2-difluoroethenyl)-5-fluoro-1H-1,2,4-triazole;ethenone |
| SMILES | C=C=O.FC(F)=Cc1n[nH]c(F)n1 |
| InChI | InChI=1S/C4H2F3N3.C2H2O/c5-2(6)1-3-8-4(7)10-9-3;1-2-3/h1H,(H,8,9,10);1H2 |
| InChIKey | LYLKITCONJZHJV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.11 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|