C5H3F4N3O — CID 91571618
ethenone;3-fluoro-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 91571618) has the molecular formula C5H3F4N3O and a molecular weight of 197.09 g/mol. Its IUPAC name is ethenone;3-fluoro-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | ethenone;3-fluoro-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 91571618 |
| Molecular Formula | C5H3F4N3O |
| Molecular Weight | 197.09 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | ethenone;3-fluoro-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | C=C=O.Fc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C3HF4N3.C2H2O/c4-2-8-1(9-10-2)3(5,6)7;1-2-3/h(H,8,9,10);1H2 |
| InChIKey | LVVUOKVEYYXQER-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|