C9H14N2O3 — CID 24975918
ethyl 3-(2-hydroxyethyl)-5-methyl-1H-pyrazole-4-carboxylate (PubChem CID 24975918) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 3-(2-hydroxyethyl)-5-methyl-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 3-(2-hydroxyethyl)-5-methyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 24975918 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | ethyl 3-(2-hydroxyethyl)-5-methyl-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(CCO)n[nH]c1C |
| InChI | InChI=1S/C9H14N2O3/c1-3-14-9(13)8-6(2)10-11-7(8)4-5-12/h12H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | KGXNXLLXFGAVFZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |