C12H13ClN2OS — CID 24976201
2-chloro-N-(2,4-dimethylphenyl)-N-(isothiocyanatomethyl)acetamide (PubChem CID 24976201) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 2-chloro-N-(2,4-dimethylphenyl)-N-(isothiocyanatomethyl)acetamide.
| Compound Name | 2-chloro-N-(2,4-dimethylphenyl)-N-(isothiocyanatomethyl)acetamide |
|---|---|
| PubChem CID | 24976201 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-chloro-N-(2,4-dimethylphenyl)-N-(isothiocyanatomethyl)acetamide |
| SMILES | Cc1ccc(N(CN=C=S)C(=O)CCl)c(C)c1 |
| InChI | InChI=1S/C12H13ClN2OS/c1-9-3-4-11(10(2)5-9)15(7-14-8-17)12(16)6-13/h3-5H,6-7H2,1-2H3 |
| InChIKey | RVZUTQRFBQRMSO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|