C15H18O — CID 24977107
(2,6-dimethylcyclohex-2-en-1-yl)-phenylmethanone (PubChem CID 24977107) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (2,6-dimethylcyclohex-2-en-1-yl)-phenylmethanone.
| Compound Name | (2,6-dimethylcyclohex-2-en-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 24977107 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (2,6-dimethylcyclohex-2-en-1-yl)-phenylmethanone |
| SMILES | CC1=CCCC(C)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O/c1-11-7-6-8-12(2)14(11)15(16)13-9-4-3-5-10-13/h3-5,7,9-10,12,14H,6,8H2,1-2H3 |
| InChIKey | RIVQPUIAJBMJLS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|