C9H12N2O3S — CID 24977574
(1E)-1-hydroxyimino-N,N-dimethyl-1-phenylmethanesulfonamide (PubChem CID 24977574) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is (1E)-1-hydroxyimino-N,N-dimethyl-1-phenylmethanesulfonamide.
| Compound Name | (1E)-1-hydroxyimino-N,N-dimethyl-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 24977574 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (1E)-1-hydroxyimino-N,N-dimethyl-1-phenylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)/C(=N/O)c1ccccc1 |
| InChI | InChI=1S/C9H12N2O3S/c1-11(2)15(13,14)9(10-12)8-6-4-3-5-7-8/h3-7,12H,1-2H3/b10-9+ |
| InChIKey | JNQMJJLQKGSEKI-MDZDMXLPSA-N |
| XLogP | 0.71 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|