C14H26O3 — CID 24977960
(5E)-8,8-diethoxy-2,6-dimethylocta-2,5-dien-4-ol (PubChem CID 24977960) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (5E)-8,8-diethoxy-2,6-dimethylocta-2,5-dien-4-ol.
| Compound Name | (5E)-8,8-diethoxy-2,6-dimethylocta-2,5-dien-4-ol |
|---|---|
| PubChem CID | 24977960 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (5E)-8,8-diethoxy-2,6-dimethylocta-2,5-dien-4-ol |
| SMILES | CCOC(C/C(C)=C/C(O)C=C(C)C)OCC |
| InChI | InChI=1S/C14H26O3/c1-6-16-14(17-7-2)10-12(5)9-13(15)8-11(3)4/h8-9,13-15H,6-7,10H2,1-5H3/b12-9+ |
| InChIKey | MABWIBQNHMQKJM-FMIVXFBMSA-N |
| XLogP | 3.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|