C12H16O6 — CID 24978226
methyl 2-[2-(3-acetyloxypropyl)-5-oxofuran-2-yl]acetate (PubChem CID 24978226) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is methyl 2-[2-(3-acetyloxypropyl)-5-oxofuran-2-yl]acetate.
| Compound Name | methyl 2-[2-(3-acetyloxypropyl)-5-oxofuran-2-yl]acetate |
|---|---|
| PubChem CID | 24978226 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl 2-[2-(3-acetyloxypropyl)-5-oxofuran-2-yl]acetate |
| SMILES | COC(=O)CC1(CCCOC(C)=O)C=CC(=O)O1 |
| InChI | InChI=1S/C12H16O6/c1-9(13)17-7-3-5-12(8-11(15)16-2)6-4-10(14)18-12/h4,6H,3,5,7-8H2,1-2H3 |
| InChIKey | NXYULHCEGUHMDO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|