C18H29FO5 — CID 91592124
tert-butyl (4R)-4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyloxolane-3-carboxylate (PubChem CID 91592124) has the molecular formula C18H29FO5 and a molecular weight of 344.42 g/mol. Its IUPAC name is tert-butyl (4R)-4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyloxolane-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 91592124 |
| Molecular Formula | C18H29FO5 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | tert-butyl (4R)-4-(5-ethoxy-4-fluoro-5-oxopent-3-enyl)-2,2-dimethyloxolane-3-carboxylate |
| SMILES | CCOC(=O)C(F)=CCC[C@H]1COC(C)(C)C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29FO5/c1-7-22-15(20)13(19)10-8-9-12-11-23-18(5,6)14(12)16(21)24-17(2,3)4/h10,12,14H,7-9,11H2,1-6H3/t12-,14?/m0/s1 |
| InChIKey | OQZLVWKGAGOSON-NBFOIZRFSA-N |
| XLogP | 3.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|