About dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate
dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate (PubChem CID 24978327) has the molecular formula C10H12N2O4
and a molecular weight of 224.22 g/mol. Its IUPAC name is dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate.
Analyze dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate?
The IUPAC name of dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate (CID 24978327) is dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate.
What is the SMILES notation for dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate?
The canonical SMILES for dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate is COC(=O)N1C=CC2C1C=CN2C(=O)OC.
What is the InChIKey of dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate?
The InChIKey is NRLYQJXMRMDLTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4/c1-15-9(13)11-5-3-8-7(11)4-6-12(8)10(14)16-2/h3-8H,1-2H3.
What are the key properties of dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate?
dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate has a molecular weight of 224.22 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3a,6a-dihydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate is sourced from PubChem (CID 24978327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).