C16H17N3O5S — CID 24979923
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 24979923) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 24979923 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NCCO)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H17N3O5S/c20-8-7-17-12-5-2-1-4-11(12)16(23)24-10-14(21)18-19-15(22)13-6-3-9-25-13/h1-6,9,17,20H,7-8,10H2,(H,18,21)(H,19,22) |
| InChIKey | RWMBDENMWCGJMA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|