C22H24ClN3O4S — CID 24981888
2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 24981888) has the molecular formula C22H24ClN3O4S and a molecular weight of 461.97 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 24981888 |
| Molecular Formula | C22H24ClN3O4S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-chloro-N-[2-(4-methoxyphenyl)ethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cc3c(cc2Cl)N2CCCCCC2=NS3(=O)=O)cc1 |
| InChI | InChI=1S/C22H24ClN3O4S/c1-30-16-8-6-15(7-9-16)10-11-24-22(27)17-13-20-19(14-18(17)23)26-12-4-2-3-5-21(26)25-31(20,28)29/h6-9,13-14H,2-5,10-12H2,1H3,(H,24,27) |
| InChIKey | PMZNTWATPSVNJM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |