C21H21Cl2N3O3S — CID 42905872
2-chloro-N-[1-(3-chlorophenyl)ethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 42905872) has the molecular formula C21H21Cl2N3O3S and a molecular weight of 466.39 g/mol. Its IUPAC name is 2-chloro-N-[1-(3-chlorophenyl)ethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | 2-chloro-N-[1-(3-chlorophenyl)ethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 42905872 |
| Molecular Formula | C21H21Cl2N3O3S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 2-chloro-N-[1-(3-chlorophenyl)ethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | CC(NC(=O)c1cc2c(cc1Cl)N1CCCCCC1=NS2(=O)=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2N3O3S/c1-13(14-6-5-7-15(22)10-14)24-21(27)16-11-19-18(12-17(16)23)26-9-4-2-3-8-20(26)25-30(19,28)29/h5-7,10-13H,2-4,8-9H2,1H3,(H,24,27) |
| InChIKey | AHFOCDFWIIGPSY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |