C20H24ClN3O5S — CID 42975358
(2-oxo-2-piperidin-1-ylethyl) 2-chloro-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxylate (PubChem CID 42975358) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-chloro-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxylate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-chloro-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxylate |
|---|---|
| PubChem CID | 42975358 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-chloro-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCC1)c1cc2c(cc1Cl)N1CCCCCC1=NS2(=O)=O |
| InChI | InChI=1S/C20H24ClN3O5S/c21-15-12-16-17(30(27,28)22-18-7-3-1-6-10-24(16)18)11-14(15)20(26)29-13-19(25)23-8-4-2-5-9-23/h11-12H,1-10,13H2 |
| InChIKey | PALGELUNZKBXHE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |