C23H26ClN3O3S — CID 26180499
2-chloro-N-[(1R)-1-(4-methylphenyl)propyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 26180499) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-(4-methylphenyl)propyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | 2-chloro-N-[(1R)-1-(4-methylphenyl)propyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 26180499 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-chloro-N-[(1R)-1-(4-methylphenyl)propyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | CC[C@@H](NC(=O)c1cc2c(cc1Cl)N1CCCCCC1=NS2(=O)=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-3-19(16-10-8-15(2)9-11-16)25-23(28)17-13-21-20(14-18(17)24)27-12-6-4-5-7-22(27)26-31(21,29)30/h8-11,13-14,19H,3-7,12H2,1-2H3,(H,25,28)/t19-/m1/s1 |
| InChIKey | YXSZGQCEAHJOCH-LJQANCHMSA-N |
| XLogP | 5.01 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |