C24H24ClN5O3S — CID 25405964
2-chloro-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 25405964) has the molecular formula C24H24ClN5O3S and a molecular weight of 498.01 g/mol. Its IUPAC name is 2-chloro-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | 2-chloro-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 25405964 |
| Molecular Formula | C24H24ClN5O3S |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-chloro-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | Cn1ccnc1[C@H](NC(=O)c1cc2c(cc1Cl)N1CCCCCC1=NS2(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C24H24ClN5O3S/c1-29-13-11-26-23(29)22(16-8-4-2-5-9-16)27-24(31)17-14-20-19(15-18(17)25)30-12-7-3-6-10-21(30)28-34(20,32)33/h2,4-5,8-9,11,13-15,22H,3,6-7,10,12H2,1H3,(H,27,31)/t22-/m1/s1 |
| InChIKey | BQUFNQUUYWEUMA-JOCHJYFZSA-N |
| XLogP | 4.07 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |