About 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine
5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine (PubChem CID 24988966) has the molecular formula C24H22N4O
and a molecular weight of 382.47 g/mol. Its IUPAC name is 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine.
Molecular Properties
| Compound Name | 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine |
| PubChem CID | 24988966 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine |
| SMILES | Cc1ccc(CNc2ccc3c(NCc4cccc5[nH]ccc45)cccc3n2)o1 |
| InChI | InChI=1S/C24H22N4O/c1-16-8-9-18(29-16)15-27-24-11-10-20-22(6-3-7-23(20)28-24)26-14-17-4-2-5-21-19(17)12-13-25-21/h2-13,25-26H,14-15H2,1H3,(H,27,28) |
| InChIKey | PQQSZXOIAKOTNK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine?
The IUPAC name of 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine (CID 24988966) is 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine.
What is the SMILES notation for 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine?
The canonical SMILES for 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine is Cc1ccc(CNc2ccc3c(NCc4cccc5[nH]ccc45)cccc3n2)o1.
What is the InChIKey of 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine?
The InChIKey is PQQSZXOIAKOTNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O/c1-16-8-9-18(29-16)15-27-24-11-10-20-22(6-3-7-23(20)28-24)26-14-17-4-2-5-21-19(17)12-13-25-21/h2-13,25-26H,14-15H2,1H3,(H,27,28).
What are the key properties of 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine?
5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine has a molecular weight of 382.47 g/mol, XLogP of 5.84, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(1H-indol-4-ylmethyl)-2-N-[(5-methylfuran-2-yl)methyl]quinoline-2,5-diamine is sourced from PubChem (CID 24988966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).