C19H19F3N4O2 — CID 24989405
1-cyclohexyl-N-methyl-4-oxo-N-(trifluoromethyl)-5H-imidazo[1,5-a]quinoxaline-8-carboxamide (PubChem CID 24989405) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 1-cyclohexyl-N-methyl-4-oxo-N-(trifluoromethyl)-5H-imidazo[1,5-a]quinoxaline-8-carboxamide.
| Compound Name | 1-cyclohexyl-N-methyl-4-oxo-N-(trifluoromethyl)-5H-imidazo[1,5-a]quinoxaline-8-carboxamide |
|---|---|
| PubChem CID | 24989405 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-cyclohexyl-N-methyl-4-oxo-N-(trifluoromethyl)-5H-imidazo[1,5-a]quinoxaline-8-carboxamide |
| SMILES | CN(C(=O)c1ccc2[nH]c(=O)c3cnc(C4CCCCC4)n3c2c1)C(F)(F)F |
| InChI | InChI=1S/C19H19F3N4O2/c1-25(19(20,21)22)18(28)12-7-8-13-14(9-12)26-15(17(27)24-13)10-23-16(26)11-5-3-2-4-6-11/h7-11H,2-6H2,1H3,(H,24,27) |
| InChIKey | MOTQKIRMRADJPL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|