C26H30FN3O3 — CID 24990816
ethyl (2S)-3-[4-(2-amino-4-fluoroanilino)phenyl]-2-[(3-oxospiro[3.5]non-1-en-1-yl)amino]propanoate (PubChem CID 24990816) has the molecular formula C26H30FN3O3 and a molecular weight of 451.54 g/mol. Its IUPAC name is ethyl (2S)-3-[4-(2-amino-4-fluoroanilino)phenyl]-2-[(3-oxospiro[3.5]non-1-en-1-yl)amino]propanoate.
| Compound Name | ethyl (2S)-3-[4-(2-amino-4-fluoroanilino)phenyl]-2-[(3-oxospiro[3.5]non-1-en-1-yl)amino]propanoate |
|---|---|
| PubChem CID | 24990816 |
| Molecular Formula | C26H30FN3O3 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | ethyl (2S)-3-[4-(2-amino-4-fluoroanilino)phenyl]-2-[(3-oxospiro[3.5]non-1-en-1-yl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(Nc2ccc(F)cc2N)cc1)NC1=CC(=O)C12CCCCC2 |
| InChI | InChI=1S/C26H30FN3O3/c1-2-33-25(32)22(30-23-16-24(31)26(23)12-4-3-5-13-26)14-17-6-9-19(10-7-17)29-21-11-8-18(27)15-20(21)28/h6-11,15-16,22,29-30H,2-5,12-14,28H2,1H3/t22-/m0/s1 |
| InChIKey | VBCVIFJICCJRQV-QFIPXVFZSA-N |
| XLogP | 4.63 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|