C25H31N5O3 — CID 91170052
ethyl (2S)-3-[4-[(3,5-diamino-2-pyridinyl)amino]phenyl]-2-[(3-oxospiro[3.5]nonan-1-ylidene)amino]propanoate (PubChem CID 91170052) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[(3,5-diamino-2-pyridinyl)amino]phenyl]-2-[(3-oxospiro[3.5]nonan-1-ylidene)amino]propanoate.
| Compound Name | ethyl (2S)-3-[4-[(3,5-diamino-2-pyridinyl)amino]phenyl]-2-[(3-oxospiro[3.5]nonan-1-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 91170052 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | ethyl (2S)-3-[4-[(3,5-diamino-2-pyridinyl)amino]phenyl]-2-[(3-oxospiro[3.5]nonan-1-ylidene)amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(Nc2ncc(N)cc2N)cc1)/N=C1\CC(=O)C12CCCCC2 |
| InChI | InChI=1S/C25H31N5O3/c1-2-33-24(32)20(30-21-14-22(31)25(21)10-4-3-5-11-25)12-16-6-8-18(9-7-16)29-23-19(27)13-17(26)15-28-23/h6-9,13,15,20H,2-5,10-12,14,26-27H2,1H3,(H,28,29)/b30-21+/t20-/m0/s1 |
| InChIKey | YFHQVAQKWFBQCY-ZOVXLITRSA-N |
| XLogP | 3.83 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|