C31H35BrN4O5 — CID 91199361
2-(2-methoxyethoxy)ethyl (2S)-2-[(2-bromo-3-oxospiro[3.5]nonan-1-ylidene)amino]-3-[4-(2,7-naphthyridin-1-ylamino)phenyl]propanoate (PubChem CID 91199361) has the molecular formula C31H35BrN4O5 and a molecular weight of 623.55 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl (2S)-2-[(2-bromo-3-oxospiro[3.5]nonan-1-ylidene)amino]-3-[4-(2,7-naphthyridin-1-ylamino)phenyl]propanoate.
| Compound Name | 2-(2-methoxyethoxy)ethyl (2S)-2-[(2-bromo-3-oxospiro[3.5]nonan-1-ylidene)amino]-3-[4-(2,7-naphthyridin-1-ylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 91199361 |
| Molecular Formula | C31H35BrN4O5 |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl (2S)-2-[(2-bromo-3-oxospiro[3.5]nonan-1-ylidene)amino]-3-[4-(2,7-naphthyridin-1-ylamino)phenyl]propanoate |
| SMILES | COCCOCCOC(=O)[C@H](Cc1ccc(Nc2nccc3ccncc23)cc1)/N=C1\C(Br)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C31H35BrN4O5/c1-39-15-16-40-17-18-41-30(38)25(36-27-26(32)28(37)31(27)11-3-2-4-12-31)19-21-5-7-23(8-6-21)35-29-24-20-33-13-9-22(24)10-14-34-29/h5-10,13-14,20,25-26H,2-4,11-12,15-19H2,1H3,(H,34,35)/b36-27+/t25-,26?/m0/s1 |
| InChIKey | PPZSITYRVXYCJJ-PPTWEXCWSA-N |
| XLogP | 5.23 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|