C20H26IN5O3 — CID 25005465
1-cyclohexylimidazo[4,5-c]quinoline-4-carboxamide;2-(methylamino)acetic acid;hydroiodide (PubChem CID 25005465) has the molecular formula C20H26IN5O3 and a molecular weight of 511.36 g/mol. Its IUPAC name is 1-cyclohexylimidazo[4,5-c]quinoline-4-carboxamide;2-(methylamino)acetic acid;hydroiodide.
| Compound Name | 1-cyclohexylimidazo[4,5-c]quinoline-4-carboxamide;2-(methylamino)acetic acid;hydroiodide |
|---|---|
| PubChem CID | 25005465 |
| Molecular Formula | C20H26IN5O3 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 1-cyclohexylimidazo[4,5-c]quinoline-4-carboxamide;2-(methylamino)acetic acid;hydroiodide |
| SMILES | CNCC(=O)O.I.NC(=O)c1nc2ccccc2c2c1ncn2C1CCCCC1 |
| InChI | InChI=1S/C17H18N4O.C3H7NO2.HI/c18-17(22)15-14-16(12-8-4-5-9-13(12)20-15)21(10-19-14)11-6-2-1-3-7-11;1-4-2-3(5)6;/h4-5,8-11H,1-3,6-7H2,(H2,18,22);4H,2H2,1H3,(H,5,6);1H |
| InChIKey | GZCPGOJCCPRCQD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|