C30H28O14 — CID 25006151
2-(4-hydroxy-3-methoxyphenyl)-7-[2-(2,3,5-trihydroxyphenoxy)-2-(3,4,5-trihydroxyphenyl)ethoxy]-3,4-dihydro-2H-chromene-3,4,5-triol (PubChem CID 25006151) has the molecular formula C30H28O14 and a molecular weight of 612.54 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenyl)-7-[2-(2,3,5-trihydroxyphenoxy)-2-(3,4,5-trihydroxyphenyl)ethoxy]-3,4-dihydro-2H-chromene-3,4,5-triol.
| Compound Name | 2-(4-hydroxy-3-methoxyphenyl)-7-[2-(2,3,5-trihydroxyphenoxy)-2-(3,4,5-trihydroxyphenyl)ethoxy]-3,4-dihydro-2H-chromene-3,4,5-triol |
|---|---|
| PubChem CID | 25006151 |
| Molecular Formula | C30H28O14 |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-7-[2-(2,3,5-trihydroxyphenoxy)-2-(3,4,5-trihydroxyphenyl)ethoxy]-3,4-dihydro-2H-chromene-3,4,5-triol |
| SMILES | COc1cc(C2Oc3cc(OCC(Oc4cc(O)cc(O)c4O)c4cc(O)c(O)c(O)c4)cc(O)c3C(O)C2O)ccc1O |
| InChI | InChI=1S/C30H28O14/c1-41-21-6-12(2-3-16(21)32)30-29(40)28(39)25-17(33)9-15(10-22(25)44-30)42-11-24(13-4-18(34)26(37)19(35)5-13)43-23-8-14(31)7-20(36)27(23)38/h2-10,24,28-40H,11H2,1H3 |
| InChIKey | AHAIAEBLOGKATC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 239.22 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|