C29H30ClN3O3 — CID 25007365
5-acetyl-6-(3-chloro-4-phenylmethoxyphenyl)-9,9-dimethyl-4a,6,8,10,11,11a-hexahydropyrido[3,4-b][1,4]benzodiazepin-7-one (PubChem CID 25007365) has the molecular formula C29H30ClN3O3 and a molecular weight of 504.03 g/mol. Its IUPAC name is 5-acetyl-6-(3-chloro-4-phenylmethoxyphenyl)-9,9-dimethyl-4a,6,8,10,11,11a-hexahydropyrido[3,4-b][1,4]benzodiazepin-7-one.
| Compound Name | 5-acetyl-6-(3-chloro-4-phenylmethoxyphenyl)-9,9-dimethyl-4a,6,8,10,11,11a-hexahydropyrido[3,4-b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 25007365 |
| Molecular Formula | C29H30ClN3O3 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 5-acetyl-6-(3-chloro-4-phenylmethoxyphenyl)-9,9-dimethyl-4a,6,8,10,11,11a-hexahydropyrido[3,4-b][1,4]benzodiazepin-7-one |
| SMILES | CC(=O)N1C(c2ccc(OCc3ccccc3)c(Cl)c2)C2=C(CC(C)(C)CC2=O)NC2C=NC=CC21 |
| InChI | InChI=1S/C29H30ClN3O3/c1-18(34)33-24-11-12-31-16-23(24)32-22-14-29(2,3)15-25(35)27(22)28(33)20-9-10-26(21(30)13-20)36-17-19-7-5-4-6-8-19/h4-13,16,23-24,28,32H,14-15,17H2,1-3H3 |
| InChIKey | DDPNLMKZUFJKAN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |