C25H28ClN3O3 — CID 25007724
5-acetyl-6-(2-chloro-4-prop-2-enoxyphenyl)-9,9-dimethyl-4a,6,8,10,11,11a-hexahydropyrido[3,4-b][1,4]benzodiazepin-7-one (PubChem CID 25007724) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is 5-acetyl-6-(2-chloro-4-prop-2-enoxyphenyl)-9,9-dimethyl-4a,6,8,10,11,11a-hexahydropyrido[3,4-b][1,4]benzodiazepin-7-one.
| Compound Name | 5-acetyl-6-(2-chloro-4-prop-2-enoxyphenyl)-9,9-dimethyl-4a,6,8,10,11,11a-hexahydropyrido[3,4-b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 25007724 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 5-acetyl-6-(2-chloro-4-prop-2-enoxyphenyl)-9,9-dimethyl-4a,6,8,10,11,11a-hexahydropyrido[3,4-b][1,4]benzodiazepin-7-one |
| SMILES | C=CCOc1ccc(C2C3=C(CC(C)(C)CC3=O)NC3C=NC=CC3N2C(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C25H28ClN3O3/c1-5-10-32-16-6-7-17(18(26)11-16)24-23-19(12-25(3,4)13-22(23)31)28-20-14-27-9-8-21(20)29(24)15(2)30/h5-9,11,14,20-21,24,28H,1,10,12-13H2,2-4H3 |
| InChIKey | WJYASLOYDMNLPB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|