C28H29ClN2O3 — CID 143735645
6-[2-chloro-4-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-1-hydroxy-9,9-dimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 143735645) has the molecular formula C28H29ClN2O3 and a molecular weight of 477.00 g/mol. Its IUPAC name is 6-[2-chloro-4-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-1-hydroxy-9,9-dimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-[2-chloro-4-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-1-hydroxy-9,9-dimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 143735645 |
| Molecular Formula | C28H29ClN2O3 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 6-[2-chloro-4-(cyclohexa-1,5-dien-1-ylmethoxy)phenyl]-1-hydroxy-9,9-dimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1c(O)cccc1NC2c1ccc(OCC2=CCCC=C2)cc1Cl |
| InChI | InChI=1S/C28H29ClN2O3/c1-28(2)14-22-25(24(33)15-28)26(30-21-9-6-10-23(32)27(21)31-22)19-12-11-18(13-20(19)29)34-16-17-7-4-3-5-8-17/h4,6-13,26,30-32H,3,5,14-16H2,1-2H3 |
| InChIKey | UTENZBGWPCZDQQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|