C32H35ClN2O5S — CID 143736119
6-(2-chloro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one;methyl 3-sulfanylpropanoate (PubChem CID 143736119) has the molecular formula C32H35ClN2O5S and a molecular weight of 595.16 g/mol. Its IUPAC name is 6-(2-chloro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one;methyl 3-sulfanylpropanoate.
| Compound Name | 6-(2-chloro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one;methyl 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 143736119 |
| Molecular Formula | C32H35ClN2O5S |
| Molecular Weight | 595.16 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 6-(2-chloro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one;methyl 3-sulfanylpropanoate |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1c(O)cccc1NC2c1ccc(OCc2ccccc2)cc1Cl.COC(=O)CCS |
| InChI | InChI=1S/C28H27ClN2O3.C4H8O2S/c1-28(2)14-22-25(24(33)15-28)26(30-21-9-6-10-23(32)27(21)31-22)19-12-11-18(13-20(19)29)34-16-17-7-4-3-5-8-17;1-6-4(5)2-3-7/h3-13,26,30-32H,14-16H2,1-2H3;7H,2-3H2,1H3 |
| InChIKey | KQLADHNTVJBWKZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.16 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|