C38H37Cl2N3O5 — CID 71070163
N-(2-chlorophenyl)-4-[6-(2-chloro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-7-oxo-2,3,6,8,10,11-hexahydrobenzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanamide (PubChem CID 71070163) has the molecular formula C38H37Cl2N3O5 and a molecular weight of 686.64 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[6-(2-chloro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-7-oxo-2,3,6,8,10,11-hexahydrobenzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanamide.
| Compound Name | N-(2-chlorophenyl)-4-[6-(2-chloro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-7-oxo-2,3,6,8,10,11-hexahydrobenzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 71070163 |
| Molecular Formula | C38H37Cl2N3O5 |
| Molecular Weight | 686.64 g/mol |
| Exact Mass | 685.21 |
| IUPAC Name | N-(2-chlorophenyl)-4-[6-(2-chloro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-7-oxo-2,3,6,8,10,11-hexahydrobenzo[b][1,4]benzodiazepin-5-yl]-4-oxobutanamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(O)CCC=C1N(C(=O)CCC(=O)Nc1ccccc1Cl)C2c1ccc(OCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C38H37Cl2N3O5/c1-38(2)20-29-35(32(45)21-38)37(25-16-15-24(19-27(25)40)48-22-23-9-4-3-5-10-23)43(30-13-8-14-31(44)36(30)42-29)34(47)18-17-33(46)41-28-12-7-6-11-26(28)39/h3-7,9-13,15-16,19,37,42,44H,8,14,17-18,20-22H2,1-2H3,(H,41,46) |
| InChIKey | YUIQOUVKLUUBBF-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.64 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |