C28H32ClN3O6 — CID 71070023
(2-amino-2-oxoethyl) 6-(4-butoxy-2-chlorophenyl)-1-hydroxy-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxylate (PubChem CID 71070023) has the molecular formula C28H32ClN3O6 and a molecular weight of 542.03 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 6-(4-butoxy-2-chlorophenyl)-1-hydroxy-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 6-(4-butoxy-2-chlorophenyl)-1-hydroxy-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 71070023 |
| Molecular Formula | C28H32ClN3O6 |
| Molecular Weight | 542.03 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | (2-amino-2-oxoethyl) 6-(4-butoxy-2-chlorophenyl)-1-hydroxy-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxylate |
| SMILES | CCCCOc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3c(O)cccc3N2C(=O)OCC(N)=O)c(Cl)c1 |
| InChI | InChI=1S/C28H32ClN3O6/c1-4-5-11-37-16-9-10-17(18(29)12-16)26-24-19(13-28(2,3)14-22(24)34)31-25-20(7-6-8-21(25)33)32(26)27(36)38-15-23(30)35/h6-10,12,26,31,33H,4-5,11,13-15H2,1-3H3,(H2,30,35) |
| InChIKey | JKHCIVLUOCDCJA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|