C33H30FN3O5 — CID 44574813
6-(2-fluoro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-5-(5-methyl-1,2-oxazole-3-carbonyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 44574813) has the molecular formula C33H30FN3O5 and a molecular weight of 567.62 g/mol. Its IUPAC name is 6-(2-fluoro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-5-(5-methyl-1,2-oxazole-3-carbonyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2-fluoro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-5-(5-methyl-1,2-oxazole-3-carbonyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 44574813 |
| Molecular Formula | C33H30FN3O5 |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 6-(2-fluoro-4-phenylmethoxyphenyl)-1-hydroxy-9,9-dimethyl-5-(5-methyl-1,2-oxazole-3-carbonyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1cc(C(=O)N2c3cccc(O)c3NC3=C(C(=O)CC(C)(C)C3)C2c2ccc(OCc3ccccc3)cc2F)no1 |
| InChI | InChI=1S/C33H30FN3O5/c1-19-14-24(36-42-19)32(40)37-26-10-7-11-27(38)30(26)35-25-16-33(2,3)17-28(39)29(25)31(37)22-13-12-21(15-23(22)34)41-18-20-8-5-4-6-9-20/h4-15,31,35,38H,16-18H2,1-3H3 |
| InChIKey | WHWBKFIIXPWRLP-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|