C31H28FN3O4S2 — CID 143736014
[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4-oxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 143736014) has the molecular formula C31H28FN3O4S2 and a molecular weight of 589.71 g/mol. Its IUPAC name is [5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4-oxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4-oxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 143736014 |
| Molecular Formula | C31H28FN3O4S2 |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | [5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4-oxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | CC1(C)CC2=C(C(c3ccc(OCc4ccccc4)cc3F)N(C(=O)c3cscn3)c3cccc(O)c3N2)S(=O)C1 |
| InChI | InChI=1S/C31H28FN3O4S2/c1-31(2)14-23-29(41(38)17-31)28(21-12-11-20(13-22(21)32)39-15-19-7-4-3-5-8-19)35(30(37)24-16-40-18-33-24)25-9-6-10-26(36)27(25)34-23/h3-13,16,18,28,34,36H,14-15,17H2,1-2H3 |
| InChIKey | TUFFCGGTPPTZLS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|