C34H29ClF2N2O4S — CID 143735715
(2-chloro-6-fluorophenyl)-[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4-oxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone (PubChem CID 143735715) has the molecular formula C34H29ClF2N2O4S and a molecular weight of 635.13 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4-oxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4-oxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone |
|---|---|
| PubChem CID | 143735715 |
| Molecular Formula | C34H29ClF2N2O4S |
| Molecular Weight | 635.13 g/mol |
| Exact Mass | 634.15 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[5-(2-fluoro-4-phenylmethoxyphenyl)-10-hydroxy-2,2-dimethyl-4-oxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]methanone |
| SMILES | CC1(C)CC2=C(C(c3ccc(OCc4ccccc4)cc3F)N(C(=O)c3c(F)cccc3Cl)c3cccc(O)c3N2)S(=O)C1 |
| InChI | InChI=1S/C34H29ClF2N2O4S/c1-34(2)17-26-32(44(42)19-34)31(22-15-14-21(16-25(22)37)43-18-20-8-4-3-5-9-20)39(27-12-7-13-28(40)30(27)38-26)33(41)29-23(35)10-6-11-24(29)36/h3-16,31,38,40H,17-19H2,1-2H3 |
| InChIKey | YAXPRQZOWSAYSA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.13 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|