C28H33Cl2N3O2 — CID 68991886
5-acetyl-2-[(butan-2-ylamino)methyl]-6-(2,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 68991886) has the molecular formula C28H33Cl2N3O2 and a molecular weight of 514.50 g/mol. Its IUPAC name is 5-acetyl-2-[(butan-2-ylamino)methyl]-6-(2,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-acetyl-2-[(butan-2-ylamino)methyl]-6-(2,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 68991886 |
| Molecular Formula | C28H33Cl2N3O2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 5-acetyl-2-[(butan-2-ylamino)methyl]-6-(2,4-dichlorophenyl)-9,9-dimethyl-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCC(C)NCc1ccc2c(c1)NC1=C(C(=O)CC(C)(C)C1)C(c1ccc(Cl)cc1Cl)N2C(C)=O |
| InChI | InChI=1S/C28H33Cl2N3O2/c1-6-16(2)31-15-18-7-10-24-22(11-18)32-23-13-28(4,5)14-25(35)26(23)27(33(24)17(3)34)20-9-8-19(29)12-21(20)30/h7-12,16,27,31-32H,6,13-15H2,1-5H3 |
| InChIKey | VHCJFIKJLYPVPZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |