C29H34Cl2N4O3 — CID 68991889
5-acetyl-6-(2,4-dichlorophenyl)-N-[1-(dimethylamino)propyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-2-carboxamide (PubChem CID 68991889) has the molecular formula C29H34Cl2N4O3 and a molecular weight of 557.52 g/mol. Its IUPAC name is 5-acetyl-6-(2,4-dichlorophenyl)-N-[1-(dimethylamino)propyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-2-carboxamide.
| Compound Name | 5-acetyl-6-(2,4-dichlorophenyl)-N-[1-(dimethylamino)propyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-2-carboxamide |
|---|---|
| PubChem CID | 68991889 |
| Molecular Formula | C29H34Cl2N4O3 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 5-acetyl-6-(2,4-dichlorophenyl)-N-[1-(dimethylamino)propyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-2-carboxamide |
| SMILES | CCC(NC(=O)c1ccc2c(c1)NC1=C(C(=O)CC(C)(C)C1)C(c1ccc(Cl)cc1Cl)N2C(C)=O)N(C)C |
| InChI | InChI=1S/C29H34Cl2N4O3/c1-7-25(34(5)6)33-28(38)17-8-11-23-21(12-17)32-22-14-29(3,4)15-24(37)26(22)27(35(23)16(2)36)19-10-9-18(30)13-20(19)31/h8-13,25,27,32H,7,14-15H2,1-6H3,(H,33,38) |
| InChIKey | QQYABBNWNAAVLW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|