C23H28O4Si — CID 25008944
5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-methoxyfuran-2-one (PubChem CID 25008944) has the molecular formula C23H28O4Si and a molecular weight of 396.56 g/mol. Its IUPAC name is 5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-methoxyfuran-2-one.
| Compound Name | 5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-methoxyfuran-2-one |
|---|---|
| PubChem CID | 25008944 |
| Molecular Formula | C23H28O4Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-methoxyfuran-2-one |
| SMILES | COC1(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CC(=O)O1 |
| InChI | InChI=1S/C23H28O4Si/c1-22(2,3)28(19-11-7-5-8-12-19,20-13-9-6-10-14-20)26-18-17-23(25-4)16-15-21(24)27-23/h5-16H,17-18H2,1-4H3 |
| InChIKey | IPGHEVQCIVJCEB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|