C23H38O2 — CID 25010496
ethyl (2E,11Z,14Z,17Z)-2-methylicosa-2,11,14,17-tetraenoate (PubChem CID 25010496) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is ethyl (2E,11Z,14Z,17Z)-2-methylicosa-2,11,14,17-tetraenoate.
| Compound Name | ethyl (2E,11Z,14Z,17Z)-2-methylicosa-2,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 25010496 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | ethyl (2E,11Z,14Z,17Z)-2-methylicosa-2,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C23H38O2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(3)23(24)25-5-2/h6-7,9-10,12-13,21H,4-5,8,11,14-20H2,1-3H3/b7-6-,10-9-,13-12-,22-21+ |
| InChIKey | FDDUAWPZNVGAAB-WAWBRSHMSA-N |
| XLogP | 7.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|