C23H25N3O2 — CID 25010701
N,N,4',5'-tetramethylspiro[1,2-dihydroindene-3,12'-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene]-8'-carboxamide (PubChem CID 25010701) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N,N,4',5'-tetramethylspiro[1,2-dihydroindene-3,12'-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene]-8'-carboxamide.
| Compound Name | N,N,4',5'-tetramethylspiro[1,2-dihydroindene-3,12'-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene]-8'-carboxamide |
|---|---|
| PubChem CID | 25010701 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N,N,4',5'-tetramethylspiro[1,2-dihydroindene-3,12'-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene]-8'-carboxamide |
| SMILES | Cc1nc2c3c(c(C(=O)N(C)C)cn2c1C)CCC1(CCc2ccccc21)O3 |
| InChI | InChI=1S/C23H25N3O2/c1-14-15(2)26-13-18(22(27)25(3)4)17-10-12-23(28-20(17)21(26)24-14)11-9-16-7-5-6-8-19(16)23/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | NCWRWPQHVWLVJS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |