C26H33F3N2O4S — CID 25011287
N-[(2-methoxyphenyl)methyl]-2-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetamide (PubChem CID 25011287) has the molecular formula C26H33F3N2O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-2-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-2-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetamide |
|---|---|
| PubChem CID | 25011287 |
| Molecular Formula | C26H33F3N2O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-2-[(3S)-2-octyl-1,1-dioxo-5-(trifluoromethyl)-3H-1,2-benzothiazol-3-yl]acetamide |
| SMILES | CCCCCCCCN1[C@@H](CC(=O)NCc2ccccc2OC)c2cc(C(F)(F)F)ccc2S1(=O)=O |
| InChI | InChI=1S/C26H33F3N2O4S/c1-3-4-5-6-7-10-15-31-22(17-25(32)30-18-19-11-8-9-12-23(19)35-2)21-16-20(26(27,28)29)13-14-24(21)36(31,33)34/h8-9,11-14,16,22H,3-7,10,15,17-18H2,1-2H3,(H,30,32)/t22-/m0/s1 |
| InChIKey | CCDOUULLEFIYTC-QFIPXVFZSA-N |
| XLogP | 5.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|