C28H29F2N3O — CID 25012989
6-[2-[4-(4,6-difluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-9,9-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-11-one (PubChem CID 25012989) has the molecular formula C28H29F2N3O and a molecular weight of 461.56 g/mol. Its IUPAC name is 6-[2-[4-(4,6-difluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-9,9-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-11-one.
| Compound Name | 6-[2-[4-(4,6-difluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-9,9-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-11-one |
|---|---|
| PubChem CID | 25012989 |
| Molecular Formula | C28H29F2N3O |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 6-[2-[4-(4,6-difluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-9,9-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-11-one |
| SMILES | CC1(C)CC(=O)N2CCc3cc(CCN4CC=C(c5c[nH]c6cc(F)cc(F)c56)CC4)cc1c32 |
| InChI | InChI=1S/C28H29F2N3O/c1-28(2)15-25(34)33-10-6-19-11-17(12-22(28)27(19)33)3-7-32-8-4-18(5-9-32)21-16-31-24-14-20(29)13-23(30)26(21)24/h4,11-14,16,31H,3,5-10,15H2,1-2H3 |
| InChIKey | WNYAFVMJPWQTLD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |