C25H24N3O3PS — CID 25013472
N-(2-amino-5-thiophen-2-ylphenyl)-4-[[methyl(pyridin-3-ylmethoxy)phosphoryl]methyl]benzamide (PubChem CID 25013472) has the molecular formula C25H24N3O3PS and a molecular weight of 477.53 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[[methyl(pyridin-3-ylmethoxy)phosphoryl]methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[methyl(pyridin-3-ylmethoxy)phosphoryl]methyl]benzamide |
|---|---|
| PubChem CID | 25013472 |
| Molecular Formula | C25H24N3O3PS |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[methyl(pyridin-3-ylmethoxy)phosphoryl]methyl]benzamide |
| SMILES | CP(=O)(Cc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1)OCc1cccnc1 |
| InChI | InChI=1S/C25H24N3O3PS/c1-32(30,31-16-19-4-2-12-27-15-19)17-18-6-8-20(9-7-18)25(29)28-23-14-21(10-11-22(23)26)24-5-3-13-33-24/h2-15H,16-17,26H2,1H3,(H,28,29) |
| InChIKey | YUGYFUOJZVHTHY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|