C16H17NO3 — CID 25015044
2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide (PubChem CID 25015044) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide.
| Compound Name | 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 25015044 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide |
| SMILES | O=C(CC1=CC=CC2C=CC=CC12)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C16H17NO3/c18-15(17-14-8-9-20-16(14)19)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-7,11,13-14H,8-10H2,(H,17,18)/t11?,13?,14-/m0/s1 |
| InChIKey | YMLUCFVYYWSRFB-UBHUBRDASA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |