About 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide
2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide (PubChem CID 25015044) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide |
| PubChem CID | 25015044 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide |
| SMILES | O=C(CC1=CC=CC2C=CC=CC12)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C16H17NO3/c18-15(17-14-8-9-20-16(14)19)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-7,11,13-14H,8-10H2,(H,17,18)/t11?,13?,14-/m0/s1 |
| InChIKey | YMLUCFVYYWSRFB-UBHUBRDASA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide?
The IUPAC name of 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide (CID 25015044) is 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide.
What is the SMILES notation for 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide?
The canonical SMILES for 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide is O=C(CC1=CC=CC2C=CC=CC12)N[C@H]1CCOC1=O.
What is the InChIKey of 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide?
The InChIKey is YMLUCFVYYWSRFB-UBHUBRDASA-N. The full InChI is InChI=1S/C16H17NO3/c18-15(17-14-8-9-20-16(14)19)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-7,11,13-14H,8-10H2,(H,17,18)/t11?,13?,14-/m0/s1.
What are the key properties of 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide?
2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide has a molecular weight of 271.32 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4a,8a-dihydronaphthalen-1-yl)-N-[(3S)-2-oxooxolan-3-yl]acetamide is sourced from PubChem (CID 25015044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).