About N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide
N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide (PubChem CID 25018369) has the molecular formula C25H34F2N2O3
and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide |
| PubChem CID | 25018369 |
| Molecular Formula | C25H34F2N2O3 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide |
| SMILES | O=C(NC1CCC(CCN2CCC(C(=O)c3ccc(F)cc3F)CC2)CC1)C1CCOC1 |
| InChI | InChI=1S/C25H34F2N2O3/c26-20-3-6-22(23(27)15-20)24(30)18-8-12-29(13-9-18)11-7-17-1-4-21(5-2-17)28-25(31)19-10-14-32-16-19/h3,6,15,17-19,21H,1-2,4-5,7-14,16H2,(H,28,31) |
| InChIKey | LVQLTPGASYCEBW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide?
The IUPAC name of N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide (CID 25018369) is N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide.
What is the SMILES notation for N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide?
The canonical SMILES for N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide is O=C(NC1CCC(CCN2CCC(C(=O)c3ccc(F)cc3F)CC2)CC1)C1CCOC1.
What is the InChIKey of N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide?
The InChIKey is LVQLTPGASYCEBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34F2N2O3/c26-20-3-6-22(23(27)15-20)24(30)18-8-12-29(13-9-18)11-7-17-1-4-21(5-2-17)28-25(31)19-10-14-32-16-19/h3,6,15,17-19,21H,1-2,4-5,7-14,16H2,(H,28,31).
What are the key properties of N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide?
N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide has a molecular weight of 448.55 g/mol, XLogP of 3.96, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]oxolane-3-carboxamide is sourced from PubChem (CID 25018369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).