C26H36FN3O4 — CID 71268472
oxan-4-yl N-[4-[2-[4-(2-cyano-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamate (PubChem CID 71268472) has the molecular formula C26H36FN3O4 and a molecular weight of 473.59 g/mol. Its IUPAC name is oxan-4-yl N-[4-[2-[4-(2-cyano-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamate.
| Compound Name | oxan-4-yl N-[4-[2-[4-(2-cyano-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 71268472 |
| Molecular Formula | C26H36FN3O4 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | oxan-4-yl N-[4-[2-[4-(2-cyano-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamate |
| SMILES | N#Cc1cc(F)ccc1OC1CCN(CCC2CCC(NC(=O)OC3CCOCC3)CC2)CC1 |
| InChI | InChI=1S/C26H36FN3O4/c27-21-3-6-25(20(17-21)18-28)33-23-8-13-30(14-9-23)12-7-19-1-4-22(5-2-19)29-26(31)34-24-10-15-32-16-11-24/h3,6,17,19,22-24H,1-2,4-5,7-16H2,(H,29,31) |
| InChIKey | HPVMLBBQOKVMQN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |