C34H43N3O4 — CID 25019027
N-[(3-methyl-4-propoxyphenyl)methyl]-N-[(3S)-2-oxoazepan-3-yl]-2-[4-[(2-phenylethylamino)methyl]phenoxy]acetamide (PubChem CID 25019027) has the molecular formula C34H43N3O4 and a molecular weight of 557.74 g/mol. Its IUPAC name is N-[(3-methyl-4-propoxyphenyl)methyl]-N-[(3S)-2-oxoazepan-3-yl]-2-[4-[(2-phenylethylamino)methyl]phenoxy]acetamide.
| Compound Name | N-[(3-methyl-4-propoxyphenyl)methyl]-N-[(3S)-2-oxoazepan-3-yl]-2-[4-[(2-phenylethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 25019027 |
| Molecular Formula | C34H43N3O4 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | N-[(3-methyl-4-propoxyphenyl)methyl]-N-[(3S)-2-oxoazepan-3-yl]-2-[4-[(2-phenylethylamino)methyl]phenoxy]acetamide |
| SMILES | CCCOc1ccc(CN(C(=O)COc2ccc(CNCCc3ccccc3)cc2)[C@H]2CCCCNC2=O)cc1C |
| InChI | InChI=1S/C34H43N3O4/c1-3-21-40-32-17-14-29(22-26(32)2)24-37(31-11-7-8-19-36-34(31)39)33(38)25-41-30-15-12-28(13-16-30)23-35-20-18-27-9-5-4-6-10-27/h4-6,9-10,12-17,22,31,35H,3,7-8,11,18-21,23-25H2,1-2H3,(H,36,39)/t31-/m0/s1 |
| InChIKey | OEQJQGOYHKGXKC-HKBQPEDESA-N |
| XLogP | 5.19 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|