C32H38N2O4 — CID 90700534
N-(1-benzyl-2-oxoazepan-3-yl)-N-[(3-methyl-4-propoxyphenyl)methyl]-2-phenoxyacetamide (PubChem CID 90700534) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is N-(1-benzyl-2-oxoazepan-3-yl)-N-[(3-methyl-4-propoxyphenyl)methyl]-2-phenoxyacetamide.
| Compound Name | N-(1-benzyl-2-oxoazepan-3-yl)-N-[(3-methyl-4-propoxyphenyl)methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 90700534 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | N-(1-benzyl-2-oxoazepan-3-yl)-N-[(3-methyl-4-propoxyphenyl)methyl]-2-phenoxyacetamide |
| SMILES | CCCOc1ccc(CN(C(=O)COc2ccccc2)C2CCCCN(Cc3ccccc3)C2=O)cc1C |
| InChI | InChI=1S/C32H38N2O4/c1-3-20-37-30-18-17-27(21-25(30)2)23-34(31(35)24-38-28-14-8-5-9-15-28)29-16-10-11-19-33(32(29)36)22-26-12-6-4-7-13-26/h4-9,12-15,17-18,21,29H,3,10-11,16,19-20,22-24H2,1-2H3 |
| InChIKey | JNKXRFUCWQBAMV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |