C35H46N4O4 — CID 90985934
2-[4-[[[4-(dimethylamino)phenyl]methylamino]methyl]phenoxy]-N-[(3-methyl-4-propoxyphenyl)methyl]-N-(2-oxoazepan-3-yl)acetamide (PubChem CID 90985934) has the molecular formula C35H46N4O4 and a molecular weight of 586.78 g/mol. Its IUPAC name is 2-[4-[[[4-(dimethylamino)phenyl]methylamino]methyl]phenoxy]-N-[(3-methyl-4-propoxyphenyl)methyl]-N-(2-oxoazepan-3-yl)acetamide.
| Compound Name | 2-[4-[[[4-(dimethylamino)phenyl]methylamino]methyl]phenoxy]-N-[(3-methyl-4-propoxyphenyl)methyl]-N-(2-oxoazepan-3-yl)acetamide |
|---|---|
| PubChem CID | 90985934 |
| Molecular Formula | C35H46N4O4 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | 2-[4-[[[4-(dimethylamino)phenyl]methylamino]methyl]phenoxy]-N-[(3-methyl-4-propoxyphenyl)methyl]-N-(2-oxoazepan-3-yl)acetamide |
| SMILES | CCCOc1ccc(CN(C(=O)COc2ccc(CNCc3ccc(N(C)C)cc3)cc2)C2CCCCNC2=O)cc1C |
| InChI | InChI=1S/C35H46N4O4/c1-5-20-42-33-18-13-29(21-26(33)2)24-39(32-8-6-7-19-37-35(32)41)34(40)25-43-31-16-11-28(12-17-31)23-36-22-27-9-14-30(15-10-27)38(3)4/h9-18,21,32,36H,5-8,19-20,22-25H2,1-4H3,(H,37,41) |
| InChIKey | IXPXVBTZRWBXMC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|