C22H25N5O3 — CID 25019255
3-[3-[(5-tert-butyl-1H-pyrazol-3-yl)carbamoylamino]phenoxy]-N-methylbenzamide (PubChem CID 25019255) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[3-[(5-tert-butyl-1H-pyrazol-3-yl)carbamoylamino]phenoxy]-N-methylbenzamide.
| Compound Name | 3-[3-[(5-tert-butyl-1H-pyrazol-3-yl)carbamoylamino]phenoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 25019255 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 3-[3-[(5-tert-butyl-1H-pyrazol-3-yl)carbamoylamino]phenoxy]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(Oc2cccc(NC(=O)Nc3cc(C(C)(C)C)[nH]n3)c2)c1 |
| InChI | InChI=1S/C22H25N5O3/c1-22(2,3)18-13-19(27-26-18)25-21(29)24-15-8-6-10-17(12-15)30-16-9-5-7-14(11-16)20(28)23-4/h5-13H,1-4H3,(H,23,28)(H3,24,25,26,27,29) |
| InChIKey | WGTGBBYSTFTSFN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |