C24H42O6 — CID 25022026
1,1,2,2-tetraethoxy-2-[4-(2-methylheptan-2-yl)phenoxy]ethanol (PubChem CID 25022026) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is 1,1,2,2-tetraethoxy-2-[4-(2-methylheptan-2-yl)phenoxy]ethanol.
| Compound Name | 1,1,2,2-tetraethoxy-2-[4-(2-methylheptan-2-yl)phenoxy]ethanol |
|---|---|
| PubChem CID | 25022026 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 1,1,2,2-tetraethoxy-2-[4-(2-methylheptan-2-yl)phenoxy]ethanol |
| SMILES | CCCCCC(C)(C)c1ccc(OC(OCC)(OCC)C(O)(OCC)OCC)cc1 |
| InChI | InChI=1S/C24H42O6/c1-8-13-14-19-22(6,7)20-15-17-21(18-16-20)30-24(28-11-4,29-12-5)23(25,26-9-2)27-10-3/h15-18,25H,8-14,19H2,1-7H3 |
| InChIKey | JYQRKXVPOVNXLO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|